C29H20N4O10 — CID 4657497
ethyl 4-(4-methoxy-2-nitroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate (PubChem CID 4657497) has the molecular formula C29H20N4O10 and a molecular weight of 584.50 g/mol. Its IUPAC name is ethyl 4-(4-methoxy-2-nitroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate.
| Compound Name | ethyl 4-(4-methoxy-2-nitroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate |
|---|---|
| PubChem CID | 4657497 |
| Molecular Formula | C29H20N4O10 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | ethyl 4-(4-methoxy-2-nitroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate |
| SMILES | CCOC(=O)C(C(=O)C(=O)Nc1ccc(OC)cc1[N+](=O)[O-])c1nc2ccc3c(c2[nH]c1=O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C29H20N4O10/c1-3-43-29(39)21(26(36)28(38)31-17-10-8-13(42-2)12-19(17)33(40)41)23-27(37)32-22-18(30-23)11-9-16-20(22)25(35)15-7-5-4-6-14(15)24(16)34/h4-12,21H,3H2,1-2H3,(H,31,38)(H,32,37) |
| InChIKey | RZMXBGUZTPXXPZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 204.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|