C22H22N4O8 — CID 21142278
2-[[3-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxy-5-methoxybenzeneamine oxide (PubChem CID 21142278) has the molecular formula C22H22N4O8 and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[[3-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxy-5-methoxybenzeneamine oxide.
| Compound Name | 2-[[3-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxy-5-methoxybenzeneamine oxide |
|---|---|
| PubChem CID | 21142278 |
| Molecular Formula | C22H22N4O8 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[[3-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxy-5-methoxybenzeneamine oxide |
| SMILES | COC(=O)C(C(=O)C(=O)Nc1ccc(OC)cc1[NH+]([O-])O)c1nc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C22H22N4O8/c1-10-7-14-15(8-11(10)2)25-20(28)18(23-14)17(22(30)34-4)19(27)21(29)24-13-6-5-12(33-3)9-16(13)26(31)32/h5-9,17,26,31H,1-4H3,(H,24,29)(H,25,28) |
| InChIKey | BRSRGXOATCYETF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 175.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|