C21H19N7O8 — CID 20844008
2-[(2Z)-1-(2-carbamoylanilino)-2-hydrazinylidene-5-methoxy-1,4,5-trioxopentan-3-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide (PubChem CID 20844008) has the molecular formula C21H19N7O8 and a molecular weight of 497.42 g/mol. Its IUPAC name is 2-[(2Z)-1-(2-carbamoylanilino)-2-hydrazinylidene-5-methoxy-1,4,5-trioxopentan-3-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide.
| Compound Name | 2-[(2Z)-1-(2-carbamoylanilino)-2-hydrazinylidene-5-methoxy-1,4,5-trioxopentan-3-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide |
|---|---|
| PubChem CID | 20844008 |
| Molecular Formula | C21H19N7O8 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-[(2Z)-1-(2-carbamoylanilino)-2-hydrazinylidene-5-methoxy-1,4,5-trioxopentan-3-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide |
| SMILES | COC(=O)C(=O)C(/C(=N/N)C(=O)Nc1ccccc1C(N)=O)c1nc2ccc([NH+]([O-])O)cc2[nH]c1=O |
| InChI | InChI=1S/C21H19N7O8/c1-36-21(33)17(29)14(15-19(31)26-13-8-9(28(34)35)6-7-12(13)24-15)16(27-23)20(32)25-11-5-3-2-4-10(11)18(22)30/h2-8,14,28,34H,23H2,1H3,(H2,22,30)(H,25,32)(H,26,31)/b27-16- |
| InChIKey | AJNGOAQGTUYGIM-YUMHPJSZSA-N |
| XLogP | -1.80 |
| TPSA | 247.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|