C24H21N7O7 — CID 20835224
4-[[(2E)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-hydrazinylidenepropanoyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 20835224) has the molecular formula C24H21N7O7 and a molecular weight of 519.47 g/mol. Its IUPAC name is 4-[[(2E)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-hydrazinylidenepropanoyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-[[(2E)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-hydrazinylidenepropanoyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 20835224 |
| Molecular Formula | C24H21N7O7 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 4-[[(2E)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-hydrazinylidenepropanoyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | N/N=C(\Cc1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O)C(=O)Nc1ccc([NH+]([O-])O)cc1[NH+]([O-])O |
| InChI | InChI=1S/C24H21N7O7/c25-29-20(24(34)27-17-9-7-15(30(35)36)11-21(17)31(37)38)12-19-23(33)28-18-10-14(6-8-16(18)26-19)22(32)13-4-2-1-3-5-13/h1-11,30-31,35,37H,12,25H2,(H,27,34)(H,28,33)/b29-20+ |
| InChIKey | VQSCEPKTUVFNES-ZTKZIYFRSA-N |
| XLogP | -0.54 |
| TPSA | 225.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|