C25H19N4O6- — CID 135720612
3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-(2-methyl-5-nitroanilino)prop-1-en-2-olate (PubChem CID 135720612) has the molecular formula C25H19N4O6- and a molecular weight of 471.45 g/mol. Its IUPAC name is 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-(2-methyl-5-nitroanilino)prop-1-en-2-olate.
| Compound Name | 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-(2-methyl-5-nitroanilino)prop-1-en-2-olate |
|---|---|
| PubChem CID | 135720612 |
| Molecular Formula | C25H19N4O6- |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-(2-methyl-5-nitroanilino)prop-1-en-2-olate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(O)=C([O-])Cc1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O |
| InChI | InChI=1S/C25H20N4O6/c1-14-7-9-17(29(34)35)12-19(14)27-25(33)22(30)13-21-24(32)28-20-11-16(8-10-18(20)26-21)23(31)15-5-3-2-4-6-15/h2-12,27,30,33H,13H2,1H3,(H,28,32)/p-1 |
| InChIKey | IHMVHKSNLSSYPN-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 161.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|