C27H34N7O5+ — CID 6334808
[2-[(2E)-2-[1-(2-tert-butyl-6-methylanilino)-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-1-oxopropan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium (PubChem CID 6334808) has the molecular formula C27H34N7O5+ and a molecular weight of 536.61 g/mol. Its IUPAC name is [2-[(2E)-2-[1-(2-tert-butyl-6-methylanilino)-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-1-oxopropan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[(2E)-2-[1-(2-tert-butyl-6-methylanilino)-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-1-oxopropan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 6334808 |
| Molecular Formula | C27H34N7O5+ |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [2-[(2E)-2-[1-(2-tert-butyl-6-methylanilino)-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-1-oxopropan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
| SMILES | Cc1cccc(C(C)(C)C)c1NC(=O)/C(Cc1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)=N/NC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C27H33N7O5/c1-16-9-8-10-18(27(2,3)4)24(16)30-26(37)22(31-32-23(35)15-34(5,6)7)14-21-25(36)29-20-13-17(33(38)39)11-12-19(20)28-21/h8-13H,14-15H2,1-7H3,(H2-,29,30,32,35,36,37)/p+1 |
| InChIKey | FCKJIJRBKWAZEO-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|