C26H22N6O6 — CID 136890876
N-[(E)-[(2R)-2-(4-acetamidophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]-2-phenylacetamide (PubChem CID 136890876) has the molecular formula C26H22N6O6 and a molecular weight of 514.50 g/mol. Its IUPAC name is N-[(E)-[(2R)-2-(4-acetamidophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]-2-phenylacetamide.
| Compound Name | N-[(E)-[(2R)-2-(4-acetamidophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 136890876 |
| Molecular Formula | C26H22N6O6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[(E)-[(2R)-2-(4-acetamidophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]-2-phenylacetamide |
| SMILES | CC(=O)Nc1ccc([C@@H](O)/C(=N/NC(=O)Cc2ccccc2)c2nc3ccc([N+](=O)[O-])cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H22N6O6/c1-15(33)27-18-9-7-17(8-10-18)25(35)23(31-30-22(34)13-16-5-3-2-4-6-16)24-26(36)29-21-14-19(32(37)38)11-12-20(21)28-24/h2-12,14,25,35H,13H2,1H3,(H,27,33)(H,29,36)(H,30,34)/b31-23+/t25-/m1/s1 |
| InChIKey | RLQJBOLRTXYLSE-ISSSRFHMSA-N |
| XLogP | 2.59 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|