C19H12Cl2N6O5 — CID 137265827
2-cyano-N-[(Z)-[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]acetamide (PubChem CID 137265827) has the molecular formula C19H12Cl2N6O5 and a molecular weight of 475.25 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]acetamide.
| Compound Name | 2-cyano-N-[(Z)-[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]acetamide |
|---|---|
| PubChem CID | 137265827 |
| Molecular Formula | C19H12Cl2N6O5 |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 2-cyano-N-[(Z)-[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]acetamide |
| SMILES | N#CCC(=O)N/N=C(/c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N6O5/c20-11-3-1-9(7-12(11)21)18(29)16(26-25-15(28)5-6-22)17-19(30)24-14-8-10(27(31)32)2-4-13(14)23-17/h1-4,7-8,18,29H,5H2,(H,24,30)(H,25,28)/b26-16- |
| InChIKey | QBXBVUOXJGQOCO-QQXSKIMKSA-N |
| XLogP | 2.61 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|