C16H11Cl2N5O4 — CID 137065978
3-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-7-nitro-1H-quinoxalin-2-one (PubChem CID 137065978) has the molecular formula C16H11Cl2N5O4 and a molecular weight of 408.20 g/mol. Its IUPAC name is 3-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-7-nitro-1H-quinoxalin-2-one.
| Compound Name | 3-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-7-nitro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 137065978 |
| Molecular Formula | C16H11Cl2N5O4 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 3-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethanehydrazonoyl]-7-nitro-1H-quinoxalin-2-one |
| SMILES | NN=C(c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N5O4/c17-9-3-1-7(5-10(9)18)15(24)13(22-19)14-16(25)21-12-6-8(23(26)27)2-4-11(12)20-14/h1-6,15,24H,19H2,(H,21,25)/t15-/m1/s1 |
| InChIKey | DEXILZZODLBGCW-OAHLLOKOSA-N |
| XLogP | 2.53 |
| TPSA | 147.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|