C16H11ClN4O5 — CID 135499201
7-chloro-3-[(E)-N-hydroxy-C-[hydroxy-(3-nitrophenyl)methyl]carbonimidoyl]-1H-quinoxalin-2-one (PubChem CID 135499201) has the molecular formula C16H11ClN4O5 and a molecular weight of 374.74 g/mol. Its IUPAC name is 7-chloro-3-[(E)-N-hydroxy-C-[hydroxy-(3-nitrophenyl)methyl]carbonimidoyl]-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-3-[(E)-N-hydroxy-C-[hydroxy-(3-nitrophenyl)methyl]carbonimidoyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135499201 |
| Molecular Formula | C16H11ClN4O5 |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 7-chloro-3-[(E)-N-hydroxy-C-[hydroxy-(3-nitrophenyl)methyl]carbonimidoyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)ccc2nc1/C(=N\O)C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11ClN4O5/c17-9-4-5-11-12(7-9)19-16(23)14(18-11)13(20-24)15(22)8-2-1-3-10(6-8)21(25)26/h1-7,15,22,24H,(H,19,23)/b20-13+ |
| InChIKey | SVSIEPUBEGWJQC-DEDYPNTBSA-N |
| XLogP | 2.40 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|