C17H12Cl2N6O5 — CID 136890882
[(E)-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea (PubChem CID 136890882) has the molecular formula C17H12Cl2N6O5 and a molecular weight of 451.23 g/mol. Its IUPAC name is [(E)-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea.
| Compound Name | [(E)-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea |
|---|---|
| PubChem CID | 136890882 |
| Molecular Formula | C17H12Cl2N6O5 |
| Molecular Weight | 451.23 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | [(E)-[(2R)-2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea |
| SMILES | NC(=O)N/N=C(\c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N6O5/c18-9-3-1-7(5-10(9)19)15(26)13(23-24-17(20)28)14-16(27)22-12-6-8(25(29)30)2-4-11(12)21-14/h1-6,15,26H,(H,22,27)(H3,20,24,28)/b23-13+/t15-/m1/s1 |
| InChIKey | JDMLZSINFBLGIL-LJGKHRNASA-N |
| XLogP | 2.24 |
| TPSA | 176.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|