C19H18N6O6S — CID 136916584
[(Z)-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]thiourea (PubChem CID 136916584) has the molecular formula C19H18N6O6S and a molecular weight of 458.46 g/mol. Its IUPAC name is [(Z)-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]thiourea.
| Compound Name | [(Z)-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 136916584 |
| Molecular Formula | C19H18N6O6S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [(Z)-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]thiourea |
| SMILES | COc1ccc([C@@H](O)/C(=N\NC(N)=S)c2nc3ccc([N+](=O)[O-])cc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C19H18N6O6S/c1-30-13-6-3-9(7-14(13)31-2)17(26)15(23-24-19(20)32)16-18(27)22-12-8-10(25(28)29)4-5-11(12)21-16/h3-8,17,26H,1-2H3,(H,22,27)(H3,20,24,32)/b23-15-/t17-/m1/s1 |
| InChIKey | VHKDCKMENDWRGL-XMSCMFJESA-N |
| XLogP | 1.12 |
| TPSA | 177.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|