C23H18N6O8S — CID 136843273
N-[(Z)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 136843273) has the molecular formula C23H18N6O8S and a molecular weight of 538.50 g/mol. Its IUPAC name is N-[(Z)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 136843273 |
| Molecular Formula | C23H18N6O8S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | N-[(Z)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(/c2nc3ccc([N+](=O)[O-])cc3[nH]c2=O)[C@@H](O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H18N6O8S/c1-13-2-9-17(10-3-13)38(36,37)27-26-20(22(30)14-4-6-15(7-5-14)28(32)33)21-23(31)25-19-12-16(29(34)35)8-11-18(19)24-21/h2-12,22,27,30H,1H3,(H,25,31)/b26-20-/t22-/m0/s1 |
| InChIKey | CTUJTVKFFGNKOR-VHAPMWFVSA-N |
| XLogP | 2.46 |
| TPSA | 210.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|