C25H22ClN5O5S — CID 137122669
N-[4-[(1S,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]phenyl]acetamide (PubChem CID 137122669) has the molecular formula C25H22ClN5O5S and a molecular weight of 540.00 g/mol. Its IUPAC name is N-[4-[(1S,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[(1S,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 137122669 |
| Molecular Formula | C25H22ClN5O5S |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-[4-[(1S,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@H](O)/C(=N/NS(=O)(=O)c2ccc(C)cc2)c2nc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H22ClN5O5S/c1-14-3-10-19(11-4-14)37(35,36)31-30-22(24(33)16-5-8-18(9-6-16)27-15(2)32)23-25(34)29-21-13-17(26)7-12-20(21)28-23/h3-13,24,31,33H,1-2H3,(H,27,32)(H,29,34)/b30-22+/t24-/m0/s1 |
| InChIKey | DCHZSJYKFGMDRZ-AANIWDRRSA-N |
| XLogP | 3.26 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|