C19H17ClN6O3S — CID 135615102
N-[4-[(2E)-2-(carbamothioylhydrazinylidene)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxyethyl]phenyl]acetamide (PubChem CID 135615102) has the molecular formula C19H17ClN6O3S and a molecular weight of 444.90 g/mol. Its IUPAC name is N-[4-[(2E)-2-(carbamothioylhydrazinylidene)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxyethyl]phenyl]acetamide.
| Compound Name | N-[4-[(2E)-2-(carbamothioylhydrazinylidene)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxyethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135615102 |
| Molecular Formula | C19H17ClN6O3S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | N-[4-[(2E)-2-(carbamothioylhydrazinylidene)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-1-hydroxyethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(O)/C(=N/NC(N)=S)c2nc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H17ClN6O3S/c1-9(27)22-12-5-2-10(3-6-12)17(28)15(25-26-19(21)30)16-18(29)24-14-8-11(20)4-7-13(14)23-16/h2-8,17,28H,1H3,(H,22,27)(H,24,29)(H3,21,26,30)/b25-15+ |
| InChIKey | VJVZKOODAXASNT-MFKUBSTISA-N |
| XLogP | 1.81 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|