C18H17ClN6O3 — CID 137105709
2-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]guanidine (PubChem CID 137105709) has the molecular formula C18H17ClN6O3 and a molecular weight of 400.83 g/mol. Its IUPAC name is 2-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]guanidine |
|---|---|
| PubChem CID | 137105709 |
| Molecular Formula | C18H17ClN6O3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]guanidine |
| SMILES | COc1ccc([C@H](O)/C(=N/N=C(N)N)c2nc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H17ClN6O3/c1-28-11-5-2-9(3-6-11)16(26)14(24-25-18(20)21)15-17(27)23-13-8-10(19)4-7-12(13)22-15/h2-8,16,26H,1H3,(H,23,27)(H4,20,21,25)/b24-14+/t16-/m0/s1 |
| InChIKey | KQPPUPMTOPQPIZ-GCMSVZMUSA-N |
| XLogP | 1.30 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|