C20H16ClN5O4 — CID 137105798
N-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]-2-cyanoacetamide (PubChem CID 137105798) has the molecular formula C20H16ClN5O4 and a molecular weight of 425.83 g/mol. Its IUPAC name is N-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]-2-cyanoacetamide.
| Compound Name | N-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 137105798 |
| Molecular Formula | C20H16ClN5O4 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-methoxyphenyl)ethylidene]amino]-2-cyanoacetamide |
| SMILES | COc1ccc([C@H](O)/C(=N/NC(=O)CC#N)c2nc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H16ClN5O4/c1-30-13-5-2-11(3-6-13)19(28)17(26-25-16(27)8-9-22)18-20(29)24-15-10-12(21)4-7-14(15)23-18/h2-7,10,19,28H,8H2,1H3,(H,24,29)(H,25,27)/b26-17+/t19-/m0/s1 |
| InChIKey | SLYSAXMODDPIHR-OJWZXOLNSA-N |
| XLogP | 2.05 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|