C19H14ClN5O3 — CID 5142505
N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-phenylethylidene]amino]-2-cyanoacetamide (PubChem CID 5142505) has the molecular formula C19H14ClN5O3 and a molecular weight of 395.81 g/mol. Its IUPAC name is N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-phenylethylidene]amino]-2-cyanoacetamide.
| Compound Name | N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-phenylethylidene]amino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 5142505 |
| Molecular Formula | C19H14ClN5O3 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-phenylethylidene]amino]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NN=C(c1nc2ccc(Cl)cc2[nH]c1=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C19H14ClN5O3/c20-12-6-7-13-14(10-12)23-19(28)17(22-13)16(25-24-15(26)8-9-21)18(27)11-4-2-1-3-5-11/h1-7,10,18,27H,8H2,(H,23,28)(H,24,26) |
| InChIKey | DVQSGQNDZUYWDE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|