C22H14Cl3N5O3 — CID 135573341
N-[(E)-[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(2,4-dichlorophenyl)-2-hydroxyethylidene]amino]pyridine-4-carboxamide (PubChem CID 135573341) has the molecular formula C22H14Cl3N5O3 and a molecular weight of 502.75 g/mol. Its IUPAC name is N-[(E)-[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(2,4-dichlorophenyl)-2-hydroxyethylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(2,4-dichlorophenyl)-2-hydroxyethylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135573341 |
| Molecular Formula | C22H14Cl3N5O3 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | N-[(E)-[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(2,4-dichlorophenyl)-2-hydroxyethylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C(\c1nc2ccc(Cl)cc2[nH]c1=O)C(O)c1ccc(Cl)cc1Cl)c1ccncc1 |
| InChI | InChI=1S/C22H14Cl3N5O3/c23-12-1-3-14(15(25)9-12)20(31)18(29-30-21(32)11-5-7-26-8-6-11)19-22(33)28-17-10-13(24)2-4-16(17)27-19/h1-10,20,31H,(H,28,33)(H,30,32)/b29-18+ |
| InChIKey | YBDXCIONGCJFGM-RDRPBHBLSA-N |
| XLogP | 4.15 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|