C23H19ClN4O5S — CID 3606838
N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(2-hydroxyphenyl)ethylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 3606838) has the molecular formula C23H19ClN4O5S and a molecular weight of 498.95 g/mol. Its IUPAC name is N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(2-hydroxyphenyl)ethylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(2-hydroxyphenyl)ethylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3606838 |
| Molecular Formula | C23H19ClN4O5S |
| Molecular Weight | 498.95 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | N-[[1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(2-hydroxyphenyl)ethylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C(c2nc3ccc(Cl)cc3[nH]c2=O)C(O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C23H19ClN4O5S/c1-13-6-9-15(10-7-13)34(32,33)28-27-20(22(30)16-4-2-3-5-19(16)29)21-23(31)26-18-12-14(24)8-11-17(18)25-21/h2-12,22,28-30H,1H3,(H,26,31) |
| InChIKey | LIHRPKOSEVISQS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|