C22H15Cl2N5O4 — CID 136866789
3-[(E)-N-anilino-C-[(R)-(2,4-dichlorophenyl)-hydroxymethyl]carbonimidoyl]-7-nitro-1H-quinoxalin-2-one (PubChem CID 136866789) has the molecular formula C22H15Cl2N5O4 and a molecular weight of 484.30 g/mol. Its IUPAC name is 3-[(E)-N-anilino-C-[(R)-(2,4-dichlorophenyl)-hydroxymethyl]carbonimidoyl]-7-nitro-1H-quinoxalin-2-one.
| Compound Name | 3-[(E)-N-anilino-C-[(R)-(2,4-dichlorophenyl)-hydroxymethyl]carbonimidoyl]-7-nitro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136866789 |
| Molecular Formula | C22H15Cl2N5O4 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 3-[(E)-N-anilino-C-[(R)-(2,4-dichlorophenyl)-hydroxymethyl]carbonimidoyl]-7-nitro-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])ccc2nc1/C(=N\Nc1ccccc1)[C@H](O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H15Cl2N5O4/c23-12-6-8-15(16(24)10-12)21(30)19(28-27-13-4-2-1-3-5-13)20-22(31)26-18-11-14(29(32)33)7-9-17(18)25-20/h1-11,21,27,30H,(H,26,31)/b28-19+/t21-/m1/s1 |
| InChIKey | HITDSWDYKXJLFC-APMPPKRVSA-N |
| XLogP | 4.69 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|