C16H12ClN5O4 — CID 136801360
7-chloro-3-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethanehydrazonoyl]-1H-quinoxalin-2-one (PubChem CID 136801360) has the molecular formula C16H12ClN5O4 and a molecular weight of 373.76 g/mol. Its IUPAC name is 7-chloro-3-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethanehydrazonoyl]-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-3-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethanehydrazonoyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136801360 |
| Molecular Formula | C16H12ClN5O4 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 7-chloro-3-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethanehydrazonoyl]-1H-quinoxalin-2-one |
| SMILES | N/N=C(\c1nc2ccc(Cl)cc2[nH]c1=O)[C@@H](O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12ClN5O4/c17-9-4-5-11-12(7-9)20-16(24)14(19-11)13(21-18)15(23)8-2-1-3-10(6-8)22(25)26/h1-7,15,23H,18H2,(H,20,24)/b21-13+/t15-/m0/s1 |
| InChIKey | UFPJKNKXVBIGBP-PCXKXAPESA-N |
| XLogP | 1.88 |
| TPSA | 147.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|