C18H15Cl2N5O4 — CID 136890851
3-[(E)-C-[(R)-(3,4-dichlorophenyl)-hydroxymethyl]-N-(dimethylamino)carbonimidoyl]-7-nitro-1H-quinoxalin-2-one (PubChem CID 136890851) has the molecular formula C18H15Cl2N5O4 and a molecular weight of 436.26 g/mol. Its IUPAC name is 3-[(E)-C-[(R)-(3,4-dichlorophenyl)-hydroxymethyl]-N-(dimethylamino)carbonimidoyl]-7-nitro-1H-quinoxalin-2-one.
| Compound Name | 3-[(E)-C-[(R)-(3,4-dichlorophenyl)-hydroxymethyl]-N-(dimethylamino)carbonimidoyl]-7-nitro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136890851 |
| Molecular Formula | C18H15Cl2N5O4 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 3-[(E)-C-[(R)-(3,4-dichlorophenyl)-hydroxymethyl]-N-(dimethylamino)carbonimidoyl]-7-nitro-1H-quinoxalin-2-one |
| SMILES | CN(C)/N=C(\c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N5O4/c1-24(2)23-15(17(26)9-3-5-11(19)12(20)7-9)16-18(27)22-14-8-10(25(28)29)4-6-13(14)21-16/h3-8,17,26H,1-2H3,(H,22,27)/b23-15+/t17-/m1/s1 |
| InChIKey | CXGNOUWWRIYXFJ-HAFIMRKLSA-N |
| XLogP | 3.14 |
| TPSA | 124.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|