C20H20ClN5O3 — CID 136774473
N-[4-[(1R,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(dimethylhydrazinylidene)-1-hydroxyethyl]phenyl]acetamide (PubChem CID 136774473) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is N-[4-[(1R,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(dimethylhydrazinylidene)-1-hydroxyethyl]phenyl]acetamide.
| Compound Name | N-[4-[(1R,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(dimethylhydrazinylidene)-1-hydroxyethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 136774473 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[4-[(1R,2E)-2-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-(dimethylhydrazinylidene)-1-hydroxyethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@@H](O)/C(=N/N(C)C)c2nc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H20ClN5O3/c1-11(27)22-14-7-4-12(5-8-14)19(28)17(25-26(2)3)18-20(29)24-16-10-13(21)6-9-15(16)23-18/h4-10,19,28H,1-3H3,(H,22,27)(H,24,29)/b25-17+/t19-/m1/s1 |
| InChIKey | RQNXHMRRCZNPME-WZGTUUFSSA-N |
| XLogP | 2.53 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|