C18H13Cl2N5O6 — CID 4145412
methyl N-[[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]carbamate (PubChem CID 4145412) has the molecular formula C18H13Cl2N5O6 and a molecular weight of 466.24 g/mol. Its IUPAC name is methyl N-[[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]carbamate.
| Compound Name | methyl N-[[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]carbamate |
|---|---|
| PubChem CID | 4145412 |
| Molecular Formula | C18H13Cl2N5O6 |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | methyl N-[[2-(3,4-dichlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]carbamate |
| SMILES | COC(=O)NN=C(c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2N5O6/c1-31-18(28)24-23-14(16(26)8-2-4-10(19)11(20)6-8)15-17(27)22-13-7-9(25(29)30)3-5-12(13)21-15/h2-7,16,26H,1H3,(H,22,27)(H,24,28) |
| InChIKey | WNADIFSABGZVDP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 159.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|