C17H13ClN6O5 — CID 135615111
[(E)-[2-(4-chlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea (PubChem CID 135615111) has the molecular formula C17H13ClN6O5 and a molecular weight of 416.78 g/mol. Its IUPAC name is [(E)-[2-(4-chlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea.
| Compound Name | [(E)-[2-(4-chlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea |
|---|---|
| PubChem CID | 135615111 |
| Molecular Formula | C17H13ClN6O5 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | [(E)-[2-(4-chlorophenyl)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)ethylidene]amino]urea |
| SMILES | NC(=O)N/N=C(\c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN6O5/c18-9-3-1-8(2-4-9)15(25)13(22-23-17(19)27)14-16(26)21-12-7-10(24(28)29)5-6-11(12)20-14/h1-7,15,25H,(H,21,26)(H3,19,23,27)/b22-13+ |
| InChIKey | BUUCNCGKBXEPPK-LPYMAVHISA-N |
| XLogP | 1.59 |
| TPSA | 176.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|