C17H15ClN8O4 — CID 136774500
2-amino-1-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-nitrophenyl)ethylidene]amino]guanidine (PubChem CID 136774500) has the molecular formula C17H15ClN8O4 and a molecular weight of 430.81 g/mol. Its IUPAC name is 2-amino-1-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-nitrophenyl)ethylidene]amino]guanidine.
| Compound Name | 2-amino-1-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-nitrophenyl)ethylidene]amino]guanidine |
|---|---|
| PubChem CID | 136774500 |
| Molecular Formula | C17H15ClN8O4 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-amino-1-[(E)-[(2S)-1-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-2-hydroxy-2-(4-nitrophenyl)ethylidene]amino]guanidine |
| SMILES | NN=C(N)N/N=C(\c1nc2ccc(Cl)cc2[nH]c1=O)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15ClN8O4/c18-9-3-6-11-12(7-9)22-16(28)14(21-11)13(24-25-17(19)23-20)15(27)8-1-4-10(5-2-8)26(29)30/h1-7,15,27H,20H2,(H,22,28)(H3,19,23,25)/b24-13+/t15-/m0/s1 |
| InChIKey | JLZNUVZPZKKHAB-MMTYYTLLSA-N |
| XLogP | 0.70 |
| TPSA | 197.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|