C17H14N8O6 — CID 136828543
2-[(E)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]guanidine (PubChem CID 136828543) has the molecular formula C17H14N8O6 and a molecular weight of 426.35 g/mol. Its IUPAC name is 2-[(E)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]guanidine |
|---|---|
| PubChem CID | 136828543 |
| Molecular Formula | C17H14N8O6 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-[(E)-[(2S)-2-hydroxy-1-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-(4-nitrophenyl)ethylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(\c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14N8O6/c18-17(19)23-22-13(15(26)8-1-3-9(4-2-8)24(28)29)14-16(27)21-12-7-10(25(30)31)5-6-11(12)20-14/h1-7,15,26H,(H,21,27)(H4,18,19,23)/b22-13+/t15-/m0/s1 |
| InChIKey | BNYLDSTYMGXKHZ-NSMHLIOHSA-N |
| XLogP | 0.45 |
| TPSA | 229.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|