C17H17N3O4 — CID 51161641
N-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]-2-phenylacetamide (PubChem CID 51161641) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 51161641 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]-2-phenylacetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H17N3O4/c1-12-7-8-14(20(23)24)10-15(12)19-17(22)11-18-16(21)9-13-5-3-2-4-6-13/h2-8,10H,9,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | QYILSTUGQKVBQM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|