C17H18N2O3S — CID 23858683
2-benzylsulfanyl-N-(2-methyl-5-nitrophenyl)propanamide (PubChem CID 23858683) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2-methyl-5-nitrophenyl)propanamide.
| Compound Name | 2-benzylsulfanyl-N-(2-methyl-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 23858683 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-benzylsulfanyl-N-(2-methyl-5-nitrophenyl)propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(C)SCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-12-8-9-15(19(21)22)10-16(12)18-17(20)13(2)23-11-14-6-4-3-5-7-14/h3-10,13H,11H2,1-2H3,(H,18,20) |
| InChIKey | DHDWNRUOBZIPMT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|