C19H16ClN5O7 — CID 21157622
5-amino-2-[[3-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 21157622) has the molecular formula C19H16ClN5O7 and a molecular weight of 461.82 g/mol. Its IUPAC name is 5-amino-2-[[3-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 5-amino-2-[[3-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21157622 |
| Molecular Formula | C19H16ClN5O7 |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 5-amino-2-[[3-(6-chloro-3-oxo-4H-quinoxalin-2-yl)-4-methoxy-2,4-dioxobutanoyl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | COC(=O)C(C(=O)C(=O)Nc1ccc(N)cc1[NH+]([O-])O)c1nc2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C19H16ClN5O7/c1-32-19(29)14(15-17(27)24-12-6-8(20)2-4-10(12)22-15)16(26)18(28)23-11-5-3-9(21)7-13(11)25(30)31/h2-7,14,25,30H,21H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | NUOSGCBJGAMPTL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 191.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|