C11H11ClN2O — CID 10944074
7-chloro-3-propan-2-yl-1H-quinoxalin-2-one (PubChem CID 10944074) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is 7-chloro-3-propan-2-yl-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-3-propan-2-yl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 10944074 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 7-chloro-3-propan-2-yl-1H-quinoxalin-2-one |
| SMILES | CC(C)c1nc2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C11H11ClN2O/c1-6(2)10-11(15)14-9-5-7(12)3-4-8(9)13-10/h3-6H,1-2H3,(H,14,15) |
| InChIKey | YMZKERNANBYOFS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |