C17H12Cl2N2O2 — CID 135493813
7-chloro-3-[(Z)-1-(4-chlorophenyl)-1-hydroxyprop-1-en-2-yl]-1H-quinoxalin-2-one (PubChem CID 135493813) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is 7-chloro-3-[(Z)-1-(4-chlorophenyl)-1-hydroxyprop-1-en-2-yl]-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-3-[(Z)-1-(4-chlorophenyl)-1-hydroxyprop-1-en-2-yl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135493813 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 7-chloro-3-[(Z)-1-(4-chlorophenyl)-1-hydroxyprop-1-en-2-yl]-1H-quinoxalin-2-one |
| SMILES | C/C(=C(/O)c1ccc(Cl)cc1)c1nc2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C17H12Cl2N2O2/c1-9(16(22)10-2-4-11(18)5-3-10)15-17(23)21-14-8-12(19)6-7-13(14)20-15/h2-8,22H,1H3,(H,21,23)/b16-9- |
| InChIKey | YNAGHGOQMIJIDT-SXGWCWSVSA-N |
| XLogP | 4.68 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|