C19H16Cl2N6O6 — CID 20844004
2-[(3E)-4-(2,5-dichloroanilino)-3-hydrazinylidene-1-methoxy-1,4-dioxobutan-2-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide (PubChem CID 20844004) has the molecular formula C19H16Cl2N6O6 and a molecular weight of 495.28 g/mol. Its IUPAC name is 2-[(3E)-4-(2,5-dichloroanilino)-3-hydrazinylidene-1-methoxy-1,4-dioxobutan-2-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide.
| Compound Name | 2-[(3E)-4-(2,5-dichloroanilino)-3-hydrazinylidene-1-methoxy-1,4-dioxobutan-2-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide |
|---|---|
| PubChem CID | 20844004 |
| Molecular Formula | C19H16Cl2N6O6 |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 2-[(3E)-4-(2,5-dichloroanilino)-3-hydrazinylidene-1-methoxy-1,4-dioxobutan-2-yl]-N-hydroxy-3-oxo-4H-quinoxalin-6-amine oxide |
| SMILES | COC(=O)C(/C(=N\N)C(=O)Nc1cc(Cl)ccc1Cl)c1nc2ccc([NH+]([O-])O)cc2[nH]c1=O |
| InChI | InChI=1S/C19H16Cl2N6O6/c1-33-19(30)14(16(26-22)18(29)24-12-6-8(20)2-4-10(12)21)15-17(28)25-13-7-9(27(31)32)3-5-11(13)23-15/h2-7,14,27,31H,22H2,1H3,(H,24,29)(H,25,28)/b26-16+ |
| InChIKey | GLQBSETXSMAQAJ-WGOQTCKBSA-N |
| XLogP | 0.84 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|