C8H9ClN2O3 — CID 163181848
2-acetamido-5-chloro-N-hydroxybenzeneamine oxide (PubChem CID 163181848) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-acetamido-5-chloro-N-hydroxybenzeneamine oxide.
| Compound Name | 2-acetamido-5-chloro-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163181848 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-acetamido-5-chloro-N-hydroxybenzeneamine oxide |
| SMILES | CC(=O)Nc1ccc(Cl)cc1[NH+]([O-])O |
| InChI | InChI=1S/C8H9ClN2O3/c1-5(12)10-7-3-2-6(9)4-8(7)11(13)14/h2-4,11,13H,1H3,(H,10,12) |
| InChIKey | ZKJSHOODYDIMFD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|