C11H10ClF6N3O3 — CID 163171806
5-chloro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]-N-hydroxybenzeneamine oxide (PubChem CID 163171806) has the molecular formula C11H10ClF6N3O3 and a molecular weight of 381.66 g/mol. Its IUPAC name is 5-chloro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]-N-hydroxybenzeneamine oxide.
| Compound Name | 5-chloro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163171806 |
| Molecular Formula | C11H10ClF6N3O3 |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 5-chloro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]-N-hydroxybenzeneamine oxide |
| SMILES | CC(NC(=O)Nc1ccc(Cl)cc1[NH+]([O-])O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10ClF6N3O3/c1-9(10(13,14)15,11(16,17)18)20-8(22)19-6-3-2-5(12)4-7(6)21(23)24/h2-4,21,23H,1H3,(H2,19,20,22) |
| InChIKey | VRBXKNUHAZPNJQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|