C14H11F9N2O3 — CID 88569168
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[4-(1-hydroxyethenyl)-2-(trifluoromethoxy)phenyl]urea (PubChem CID 88569168) has the molecular formula C14H11F9N2O3 and a molecular weight of 426.24 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[4-(1-hydroxyethenyl)-2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[4-(1-hydroxyethenyl)-2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 88569168 |
| Molecular Formula | C14H11F9N2O3 |
| Molecular Weight | 426.24 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[4-(1-hydroxyethenyl)-2-(trifluoromethoxy)phenyl]urea |
| SMILES | C=C(O)c1ccc(NC(=O)NC(C)(C(F)(F)F)C(F)(F)F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F9N2O3/c1-6(26)7-3-4-8(9(5-7)28-14(21,22)23)24-10(27)25-11(2,12(15,16)17)13(18,19)20/h3-5,26H,1H2,2H3,(H2,24,25,27) |
| InChIKey | URPADOXOIVJTHP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|