C16H11BrF3NO4 — CID 99793528
methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]carbamoyl]benzoate (PubChem CID 99793528) has the molecular formula C16H11BrF3NO4 and a molecular weight of 418.17 g/mol. Its IUPAC name is methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 99793528 |
| Molecular Formula | C16H11BrF3NO4 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(Br)cc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11BrF3NO4/c1-24-15(23)10-4-2-9(3-5-10)14(22)21-12-7-6-11(17)8-13(12)25-16(18,19)20/h2-8H,1H3,(H,21,22) |
| InChIKey | GJITUPKLLSWYCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |