C11H12BrF3N2O2S — CID 103193046
1-[4-bromo-2-(trifluoromethoxy)phenyl]-3-(2-methoxyethyl)thiourea (PubChem CID 103193046) has the molecular formula C11H12BrF3N2O2S and a molecular weight of 373.19 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethoxy)phenyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 103193046 |
| Molecular Formula | C11H12BrF3N2O2S |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H12BrF3N2O2S/c1-18-5-4-16-10(20)17-8-3-2-7(12)6-9(8)19-11(13,14)15/h2-3,6H,4-5H2,1H3,(H2,16,17,20) |
| InChIKey | HWWZCQOITPDFSW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|