C11H10Br2F3NO2 — CID 103193041
2-bromo-N-[4-bromo-2-(trifluoromethoxy)phenyl]butanamide (PubChem CID 103193041) has the molecular formula C11H10Br2F3NO2 and a molecular weight of 405.01 g/mol. Its IUPAC name is 2-bromo-N-[4-bromo-2-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 2-bromo-N-[4-bromo-2-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 103193041 |
| Molecular Formula | C11H10Br2F3NO2 |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | 2-bromo-N-[4-bromo-2-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CCC(Br)C(=O)Nc1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H10Br2F3NO2/c1-2-7(13)10(18)17-8-4-3-6(12)5-9(8)19-11(14,15)16/h3-5,7H,2H2,1H3,(H,17,18) |
| InChIKey | FZSVLXPBFQBHKP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|