C12H12BrF3N2O2 — CID 103193279
2-amino-N-[4-bromo-2-(trifluoromethoxy)phenyl]pent-4-enamide (PubChem CID 103193279) has the molecular formula C12H12BrF3N2O2 and a molecular weight of 353.14 g/mol. Its IUPAC name is 2-amino-N-[4-bromo-2-(trifluoromethoxy)phenyl]pent-4-enamide.
| Compound Name | 2-amino-N-[4-bromo-2-(trifluoromethoxy)phenyl]pent-4-enamide |
|---|---|
| PubChem CID | 103193279 |
| Molecular Formula | C12H12BrF3N2O2 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-amino-N-[4-bromo-2-(trifluoromethoxy)phenyl]pent-4-enamide |
| SMILES | C=CCC(N)C(=O)Nc1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C12H12BrF3N2O2/c1-2-3-8(17)11(19)18-9-5-4-7(13)6-10(9)20-12(14,15)16/h2,4-6,8H,1,3,17H2,(H,18,19) |
| InChIKey | CYOUGTPUCUBTAW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|