C18H18BrF3NO4P — CID 71174212
N-(4-bromo-2-diethoxyphosphanylphenyl)-4-(trifluoromethoxy)benzamide (PubChem CID 71174212) has the molecular formula C18H18BrF3NO4P and a molecular weight of 480.22 g/mol. Its IUPAC name is N-(4-bromo-2-diethoxyphosphanylphenyl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(4-bromo-2-diethoxyphosphanylphenyl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 71174212 |
| Molecular Formula | C18H18BrF3NO4P |
| Molecular Weight | 480.22 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | N-(4-bromo-2-diethoxyphosphanylphenyl)-4-(trifluoromethoxy)benzamide |
| SMILES | CCOP(OCC)c1cc(Br)ccc1NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18BrF3NO4P/c1-3-25-28(26-4-2)16-11-13(19)7-10-15(16)23-17(24)12-5-8-14(9-6-12)27-18(20,21)22/h5-11H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | SGOGBEXDVVNZTH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.22 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|