C16H13BrF3NO5S — CID 3863596
methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-methylamino]benzoate (PubChem CID 3863596) has the molecular formula C16H13BrF3NO5S and a molecular weight of 468.25 g/mol. Its IUPAC name is methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-methylamino]benzoate.
| Compound Name | methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-methylamino]benzoate |
|---|---|
| PubChem CID | 3863596 |
| Molecular Formula | C16H13BrF3NO5S |
| Molecular Weight | 468.25 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | methyl 4-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-methylamino]benzoate |
| SMILES | COC(=O)c1ccc(N(C)S(=O)(=O)c2ccc(Br)cc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13BrF3NO5S/c1-21(12-6-3-10(4-7-12)15(22)25-2)27(23,24)14-8-5-11(17)9-13(14)26-16(18,19)20/h3-9H,1-2H3 |
| InChIKey | DNJQADMPGULYBN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |