C17H15BrF3NO4S — CID 5220861
4-bromo-N-(4-butanoylphenyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 5220861) has the molecular formula C17H15BrF3NO4S and a molecular weight of 466.28 g/mol. Its IUPAC name is 4-bromo-N-(4-butanoylphenyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-(4-butanoylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 5220861 |
| Molecular Formula | C17H15BrF3NO4S |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 4-bromo-N-(4-butanoylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCCC(=O)c1ccc(NS(=O)(=O)c2ccc(Br)cc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15BrF3NO4S/c1-2-3-14(23)11-4-7-13(8-5-11)22-27(24,25)16-9-6-12(18)10-15(16)26-17(19,20)21/h4-10,22H,2-3H2,1H3 |
| InChIKey | YDDAEECQROGQHG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |