C15H22F3N3O3 — CID 89492902
1-[2-(3-aminopropoxy)-5-(trifluoromethoxy)phenyl]-3-tert-butylurea (PubChem CID 89492902) has the molecular formula C15H22F3N3O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-[2-(3-aminopropoxy)-5-(trifluoromethoxy)phenyl]-3-tert-butylurea.
| Compound Name | 1-[2-(3-aminopropoxy)-5-(trifluoromethoxy)phenyl]-3-tert-butylurea |
|---|---|
| PubChem CID | 89492902 |
| Molecular Formula | C15H22F3N3O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[2-(3-aminopropoxy)-5-(trifluoromethoxy)phenyl]-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)Nc1cc(OC(F)(F)F)ccc1OCCCN |
| InChI | InChI=1S/C15H22F3N3O3/c1-14(2,3)21-13(22)20-11-9-10(24-15(16,17)18)5-6-12(11)23-8-4-7-19/h5-6,9H,4,7-8,19H2,1-3H3,(H2,20,21,22) |
| InChIKey | ABYQQLIFGOBYII-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|