C14H21ClN2O4S — CID 122143492
1-tert-butyl-3-[5-chloro-2-(2-methylsulfonylethoxy)phenyl]urea (PubChem CID 122143492) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is 1-tert-butyl-3-[5-chloro-2-(2-methylsulfonylethoxy)phenyl]urea.
| Compound Name | 1-tert-butyl-3-[5-chloro-2-(2-methylsulfonylethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122143492 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-tert-butyl-3-[5-chloro-2-(2-methylsulfonylethoxy)phenyl]urea |
| SMILES | CC(C)(C)NC(=O)Nc1cc(Cl)ccc1OCCS(C)(=O)=O |
| InChI | InChI=1S/C14H21ClN2O4S/c1-14(2,3)17-13(18)16-11-9-10(15)5-6-12(11)21-7-8-22(4,19)20/h5-6,9H,7-8H2,1-4H3,(H2,16,17,18) |
| InChIKey | GAMPNHUJFOHAEQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |