C16H25ClN2O3 — CID 56555388
1-(5-chloro-2-propoxyphenyl)-3-(2-ethyl-2-hydroxybutyl)urea (PubChem CID 56555388) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is 1-(5-chloro-2-propoxyphenyl)-3-(2-ethyl-2-hydroxybutyl)urea.
| Compound Name | 1-(5-chloro-2-propoxyphenyl)-3-(2-ethyl-2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 56555388 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-(5-chloro-2-propoxyphenyl)-3-(2-ethyl-2-hydroxybutyl)urea |
| SMILES | CCCOc1ccc(Cl)cc1NC(=O)NCC(O)(CC)CC |
| InChI | InChI=1S/C16H25ClN2O3/c1-4-9-22-14-8-7-12(17)10-13(14)19-15(20)18-11-16(21,5-2)6-3/h7-8,10,21H,4-6,9,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | VKLMXYBOQNATCU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |