C17H18ClN3O4 — CID 75400136
1-(5-chloro-2-propoxyphenyl)-3-[(3-hydroxybenzoyl)amino]urea (PubChem CID 75400136) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 1-(5-chloro-2-propoxyphenyl)-3-[(3-hydroxybenzoyl)amino]urea.
| Compound Name | 1-(5-chloro-2-propoxyphenyl)-3-[(3-hydroxybenzoyl)amino]urea |
|---|---|
| PubChem CID | 75400136 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-(5-chloro-2-propoxyphenyl)-3-[(3-hydroxybenzoyl)amino]urea |
| SMILES | CCCOc1ccc(Cl)cc1NC(=O)NNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C17H18ClN3O4/c1-2-8-25-15-7-6-12(18)10-14(15)19-17(24)21-20-16(23)11-4-3-5-13(22)9-11/h3-7,9-10,22H,2,8H2,1H3,(H,20,23)(H2,19,21,24) |
| InChIKey | CSNQLJJWUNFSLG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|