C14H20F3NO2 — CID 89492673
3-[2-tert-butyl-4-(trifluoromethoxy)phenoxy]propan-1-amine (PubChem CID 89492673) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-[2-tert-butyl-4-(trifluoromethoxy)phenoxy]propan-1-amine.
| Compound Name | 3-[2-tert-butyl-4-(trifluoromethoxy)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 89492673 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-[2-tert-butyl-4-(trifluoromethoxy)phenoxy]propan-1-amine |
| SMILES | CC(C)(C)c1cc(OC(F)(F)F)ccc1OCCCN |
| InChI | InChI=1S/C14H20F3NO2/c1-13(2,3)11-9-10(20-14(15,16)17)5-6-12(11)19-8-4-7-18/h5-6,9H,4,7-8,18H2,1-3H3 |
| InChIKey | LSISUJVMFHLKKV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|