C16H14ClF6NO2 — CID 163408359
2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenoxy]ethanamine;hydrochloride (PubChem CID 163408359) has the molecular formula C16H14ClF6NO2 and a molecular weight of 401.73 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenoxy]ethanamine;hydrochloride.
| Compound Name | 2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenoxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 163408359 |
| Molecular Formula | C16H14ClF6NO2 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenoxy]ethanamine;hydrochloride |
| SMILES | Cl.NCCOc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13F6NO2.ClH/c17-15(18,19)13-9-11(3-6-14(13)24-8-7-23)10-1-4-12(5-2-10)25-16(20,21)22;/h1-6,9H,7-8,23H2;1H |
| InChIKey | OLYOZLAUFDQEEN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |